C26H53NOSi — CID 91751671
(E,E)-N-[tert-butyl(dimethyl)silyl]oxy-3,7,11,15-tetramethylhexadec-2-en-1-imine (PubChem CID 91751671) has the molecular formula C26H53NOSi and a molecular weight of 423.80 g/mol. Its IUPAC name is (E,E)-N-[tert-butyl(dimethyl)silyl]oxy-3,7,11,15-tetramethylhexadec-2-en-1-imine.
| Compound Name | (E,E)-N-[tert-butyl(dimethyl)silyl]oxy-3,7,11,15-tetramethylhexadec-2-en-1-imine |
|---|---|
| PubChem CID | 91751671 |
| Molecular Formula | C26H53NOSi |
| Molecular Weight | 423.80 g/mol |
| Exact Mass | 423.39 |
| IUPAC Name | (E,E)-N-[tert-butyl(dimethyl)silyl]oxy-3,7,11,15-tetramethylhexadec-2-en-1-imine |
| SMILES | C/C(=C\C=N\O[Si](C)(C)C(C)(C)C)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C26H53NOSi/c1-22(2)14-11-15-23(3)16-12-17-24(4)18-13-19-25(5)20-21-27-28-29(9,10)26(6,7)8/h20-24H,11-19H2,1-10H3/b25-20+,27-21+ |
| InChIKey | MOBOBCCDGDMJAQ-HPIQBAMUSA-N |
| XLogP | 9.38 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.80 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|