C27H46O2Si2 — CID 91751739
ethenyl-[[(3S,10R,13S,17S)-3-[ethenyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]-dimethylsilane (PubChem CID 91751739) has the molecular formula C27H46O2Si2 and a molecular weight of 458.84 g/mol. Its IUPAC name is ethenyl-[[(3S,10R,13S,17S)-3-[ethenyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]-dimethylsilane.
| Compound Name | ethenyl-[[(3S,10R,13S,17S)-3-[ethenyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 91751739 |
| Molecular Formula | C27H46O2Si2 |
| Molecular Weight | 458.84 g/mol |
| Exact Mass | 458.30 |
| IUPAC Name | ethenyl-[[(3S,10R,13S,17S)-3-[ethenyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]-dimethylsilane |
| SMILES | C=C[Si](C)(C)O[C@H]1CC[C@@]2(C)C(=CCC3C2CC[C@@]2(C)C3CC[C@@H]2O[Si](C)(C)C=C)C1 |
| InChI | InChI=1S/C27H46O2Si2/c1-9-30(5,6)28-21-15-17-26(3)20(19-21)11-12-22-23-13-14-25(29-31(7,8)10-2)27(23,4)18-16-24(22)26/h9-11,21-25H,1-2,12-19H2,3-8H3/t21-,22?,23?,24?,25-,26-,27-/m0/s1 |
| InChIKey | KDONFZABKNWBNT-ATZSCKIZSA-N |
| XLogP | 7.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.84 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|