C25H40O2Si — CID 91751745
1-[(3S,10R,13S,17S)-3-[ethenyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 91751745) has the molecular formula C25H40O2Si and a molecular weight of 400.68 g/mol. Its IUPAC name is 1-[(3S,10R,13S,17S)-3-[ethenyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 1-[(3S,10R,13S,17S)-3-[ethenyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 91751745 |
| Molecular Formula | C25H40O2Si |
| Molecular Weight | 400.68 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | 1-[(3S,10R,13S,17S)-3-[ethenyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | C=C[Si](C)(C)O[C@H]1CC[C@@]2(C)C(=CCC3C2CC[C@@]2(C)C3CC[C@@H]2C(C)=O)C1 |
| InChI | InChI=1S/C25H40O2Si/c1-7-28(5,6)27-19-12-14-24(3)18(16-19)8-9-20-22-11-10-21(17(2)26)25(22,4)15-13-23(20)24/h7-8,19-23H,1,9-16H2,2-6H3/t19-,20?,21+,22?,23?,24-,25+/m0/s1 |
| InChIKey | IXUFWZYALROGLB-AXIHMCAASA-N |
| XLogP | 6.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.68 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|