C29H52O3Si — CID 91751862
methyl (4R)-4-[(5R,8R,9S,10S,12S,13R,14S,17R)-12-[ethyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 91751862) has the molecular formula C29H52O3Si and a molecular weight of 476.82 g/mol. Its IUPAC name is methyl (4R)-4-[(5R,8R,9S,10S,12S,13R,14S,17R)-12-[ethyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl (4R)-4-[(5R,8R,9S,10S,12S,13R,14S,17R)-12-[ethyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 91751862 |
| Molecular Formula | C29H52O3Si |
| Molecular Weight | 476.82 g/mol |
| Exact Mass | 476.37 |
| IUPAC Name | methyl (4R)-4-[(5R,8R,9S,10S,12S,13R,14S,17R)-12-[ethyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | CC[Si](C)(C)O[C@H]1C[C@H]2[C@@H](CC[C@H]3CCCC[C@@]32C)[C@@H]2CC[C@H]([C@H](C)CCC(=O)OC)[C@@]12C |
| InChI | InChI=1S/C29H52O3Si/c1-8-33(6,7)32-26-19-25-22(14-13-21-11-9-10-18-28(21,25)3)24-16-15-23(29(24,26)4)20(2)12-17-27(30)31-5/h20-26H,8-19H2,1-7H3/t20-,21-,22+,23-,24+,25+,26+,28+,29-/m1/s1 |
| InChIKey | DBDZGEARTPZCLG-ACBSTCGXSA-N |
| XLogP | 7.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.82 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|