About [4-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-oxo-1-propanoyloxyethyl]phenyl] propanoate
[4-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-oxo-1-propanoyloxyethyl]phenyl] propanoate (PubChem CID 91752061) has the molecular formula C23H20F6O6
and a molecular weight of 506.40 g/mol. Its IUPAC name is [4-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-oxo-1-propanoyloxyethyl]phenyl] propanoate.
Molecular Properties
| Compound Name | [4-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-oxo-1-propanoyloxyethyl]phenyl] propanoate |
| PubChem CID | 91752061 |
| Molecular Formula | C23H20F6O6 |
| Molecular Weight | 506.40 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | [4-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-oxo-1-propanoyloxyethyl]phenyl] propanoate |
| SMILES | CCC(=O)Oc1ccc(C(OC(=O)CC)C(=O)OCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C23H20F6O6/c1-3-18(30)34-17-7-5-14(6-8-17)20(35-19(31)4-2)21(32)33-12-13-9-15(22(24,25)26)11-16(10-13)23(27,28)29/h5-11,20H,3-4,12H2,1-2H3 |
| InChIKey | NLHBPFNXDVJVDB-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 506.40 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-oxo-1-propanoyloxyethyl]phenyl] propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-oxo-1-propanoyloxyethyl]phenyl] propanoate?
The IUPAC name of [4-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-oxo-1-propanoyloxyethyl]phenyl] propanoate (CID 91752061) is [4-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-oxo-1-propanoyloxyethyl]phenyl] propanoate.
What is the SMILES notation for [4-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-oxo-1-propanoyloxyethyl]phenyl] propanoate?
The canonical SMILES for [4-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-oxo-1-propanoyloxyethyl]phenyl] propanoate is CCC(=O)Oc1ccc(C(OC(=O)CC)C(=O)OCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1.
What is the InChIKey of [4-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-oxo-1-propanoyloxyethyl]phenyl] propanoate?
The InChIKey is NLHBPFNXDVJVDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20F6O6/c1-3-18(30)34-17-7-5-14(6-8-17)20(35-19(31)4-2)21(32)33-12-13-9-15(22(24,25)26)11-16(10-13)23(27,28)29/h5-11,20H,3-4,12H2,1-2H3.
What are the key properties of [4-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-oxo-1-propanoyloxyethyl]phenyl] propanoate?
[4-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-oxo-1-propanoyloxyethyl]phenyl] propanoate has a molecular weight of 506.40 g/mol, XLogP of 5.78, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-oxo-1-propanoyloxyethyl]phenyl] propanoate is sourced from PubChem (CID 91752061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).