C13H20O2 — CID 91752242
4-(hydroxymethyl)-2,2-dimethyl-6-methylidene-3,5,7,7a-tetrahydro-1H-inden-1-ol (PubChem CID 91752242) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 4-(hydroxymethyl)-2,2-dimethyl-6-methylidene-3,5,7,7a-tetrahydro-1H-inden-1-ol.
| Compound Name | 4-(hydroxymethyl)-2,2-dimethyl-6-methylidene-3,5,7,7a-tetrahydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 91752242 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 4-(hydroxymethyl)-2,2-dimethyl-6-methylidene-3,5,7,7a-tetrahydro-1H-inden-1-ol |
| SMILES | C=C1CC(CO)=C2CC(C)(C)C(O)C2C1 |
| InChI | InChI=1S/C13H20O2/c1-8-4-9(7-14)11-6-13(2,3)12(15)10(11)5-8/h10,12,14-15H,1,4-7H2,2-3H3 |
| InChIKey | VCIVBLZCBOWLMD-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|