C17H11F15O10 — CID 91752380
methyl 6-methoxy-3,4,5-tris(2,2,3,3,3-pentafluoropropanoyloxy)oxane-2-carboxylate (PubChem CID 91752380) has the molecular formula C17H11F15O10 and a molecular weight of 660.23 g/mol. Its IUPAC name is methyl 6-methoxy-3,4,5-tris(2,2,3,3,3-pentafluoropropanoyloxy)oxane-2-carboxylate.
| Compound Name | methyl 6-methoxy-3,4,5-tris(2,2,3,3,3-pentafluoropropanoyloxy)oxane-2-carboxylate |
|---|---|
| PubChem CID | 91752380 |
| Molecular Formula | C17H11F15O10 |
| Molecular Weight | 660.23 g/mol |
| Exact Mass | 660.01 |
| IUPAC Name | methyl 6-methoxy-3,4,5-tris(2,2,3,3,3-pentafluoropropanoyloxy)oxane-2-carboxylate |
| SMILES | COC(=O)C1OC(OC)C(OC(=O)C(F)(F)C(F)(F)F)C(OC(=O)C(F)(F)C(F)(F)F)C1OC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H11F15O10/c1-37-7(33)5-3(40-9(34)12(18,19)15(24,25)26)4(41-10(35)13(20,21)16(27,28)29)6(8(38-2)39-5)42-11(36)14(22,23)17(30,31)32/h3-6,8H,1-2H3 |
| InChIKey | VIHBWXQWOPROMY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.23 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|