C18H28O10 — CID 91752394
methyl 3,4,5-triacetyloxy-6-[(2S)-2-methylbutoxy]oxane-2-carboxylate (PubChem CID 91752394) has the molecular formula C18H28O10 and a molecular weight of 404.41 g/mol. Its IUPAC name is methyl 3,4,5-triacetyloxy-6-[(2S)-2-methylbutoxy]oxane-2-carboxylate.
| Compound Name | methyl 3,4,5-triacetyloxy-6-[(2S)-2-methylbutoxy]oxane-2-carboxylate |
|---|---|
| PubChem CID | 91752394 |
| Molecular Formula | C18H28O10 |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | methyl 3,4,5-triacetyloxy-6-[(2S)-2-methylbutoxy]oxane-2-carboxylate |
| SMILES | CC[C@H](C)COC1OC(C(=O)OC)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C18H28O10/c1-7-9(2)8-24-18-16(27-12(5)21)14(26-11(4)20)13(25-10(3)19)15(28-18)17(22)23-6/h9,13-16,18H,7-8H2,1-6H3/t9-,13?,14?,15?,16?,18?/m0/s1 |
| InChIKey | SAAKTKDFADNNST-CAGIVTDKSA-N |
| XLogP | 0.74 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|