C24H40O3Si — CID 91752486
methyl (1R,2R,5R,9S,12R,13R)-5,9,13-trimethyl-2-trimethylsilyloxypentacyclo[11.2.1.01,10.04,9.012,14]hexadecane-5-carboxylate (PubChem CID 91752486) has the molecular formula C24H40O3Si and a molecular weight of 404.67 g/mol. Its IUPAC name is methyl (1R,2R,5R,9S,12R,13R)-5,9,13-trimethyl-2-trimethylsilyloxypentacyclo[11.2.1.01,10.04,9.012,14]hexadecane-5-carboxylate.
| Compound Name | methyl (1R,2R,5R,9S,12R,13R)-5,9,13-trimethyl-2-trimethylsilyloxypentacyclo[11.2.1.01,10.04,9.012,14]hexadecane-5-carboxylate |
|---|---|
| PubChem CID | 91752486 |
| Molecular Formula | C24H40O3Si |
| Molecular Weight | 404.67 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | methyl (1R,2R,5R,9S,12R,13R)-5,9,13-trimethyl-2-trimethylsilyloxypentacyclo[11.2.1.01,10.04,9.012,14]hexadecane-5-carboxylate |
| SMILES | COC(=O)[C@]1(C)CCC[C@@]2(C)C3C[C@@H]4C5C[C@]3(C[C@@]54C)[C@H](O[Si](C)(C)C)CC21 |
| InChI | InChI=1S/C24H40O3Si/c1-21-9-8-10-22(2,20(25)26-4)17(21)12-19(27-28(5,6)7)24-13-16-15(11-18(21)24)23(16,3)14-24/h15-19H,8-14H2,1-7H3/t15-,16?,17?,18?,19-,21-,22-,23-,24-/m1/s1 |
| InChIKey | NSQQWIMKIXFQDW-NMYVPERSSA-N |
| XLogP | 5.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.67 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|