C14H30O — CID 91752497
2,2,4-trimethyl-4-(4-methylpentoxy)pentane (PubChem CID 91752497) has the molecular formula C14H30O and a molecular weight of 214.39 g/mol. Its IUPAC name is 2,2,4-trimethyl-4-(4-methylpentoxy)pentane.
| Compound Name | 2,2,4-trimethyl-4-(4-methylpentoxy)pentane |
|---|---|
| PubChem CID | 91752497 |
| Molecular Formula | C14H30O |
| Molecular Weight | 214.39 g/mol |
| Exact Mass | 214.23 |
| IUPAC Name | 2,2,4-trimethyl-4-(4-methylpentoxy)pentane |
| SMILES | CC(C)CCCOC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C14H30O/c1-12(2)9-8-10-15-14(6,7)11-13(3,4)5/h12H,8-11H2,1-7H3 |
| InChIKey | UUBSLYFKXOFLCA-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.39 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|