C15H20O — CID 91752521
(1R,2R,4R)-3,3,7-trimethyl-12-methylidene-10-oxatricyclo[6.4.0.02,4]dodeca-6,8-diene (PubChem CID 91752521) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is (1R,2R,4R)-3,3,7-trimethyl-12-methylidene-10-oxatricyclo[6.4.0.02,4]dodeca-6,8-diene.
| Compound Name | (1R,2R,4R)-3,3,7-trimethyl-12-methylidene-10-oxatricyclo[6.4.0.02,4]dodeca-6,8-diene |
|---|---|
| PubChem CID | 91752521 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | (1R,2R,4R)-3,3,7-trimethyl-12-methylidene-10-oxatricyclo[6.4.0.02,4]dodeca-6,8-diene |
| SMILES | C=C1COC=C2C(C)=CC[C@@H]3[C@H]([C@H]12)C3(C)C |
| InChI | InChI=1S/C15H20O/c1-9-5-6-12-14(15(12,3)4)13-10(2)7-16-8-11(9)13/h5,8,12-14H,2,6-7H2,1,3-4H3/t12-,13-,14-/m1/s1 |
| InChIKey | MPCQKDYYHFZZAW-MGPQQGTHSA-N |
| XLogP | 3.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|