About bis[tert-butyl(dimethyl)silyl] 2,2-dimethylbutanedioate
bis[tert-butyl(dimethyl)silyl] 2,2-dimethylbutanedioate (PubChem CID 91752559) has the molecular formula C18H38O4Si2
and a molecular weight of 374.67 g/mol. Its IUPAC name is bis[tert-butyl(dimethyl)silyl] 2,2-dimethylbutanedioate.
Molecular Properties
| Compound Name | bis[tert-butyl(dimethyl)silyl] 2,2-dimethylbutanedioate |
| PubChem CID | 91752559 |
| Molecular Formula | C18H38O4Si2 |
| Molecular Weight | 374.67 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | bis[tert-butyl(dimethyl)silyl] 2,2-dimethylbutanedioate |
| SMILES | CC(C)(CC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H38O4Si2/c1-16(2,3)23(9,10)21-14(19)13-18(7,8)15(20)22-24(11,12)17(4,5)6/h13H2,1-12H3 |
| InChIKey | IUXVNTDYFCZPOF-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.67 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis[tert-butyl(dimethyl)silyl] 2,2-dimethylbutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[tert-butyl(dimethyl)silyl] 2,2-dimethylbutanedioate?
The IUPAC name of bis[tert-butyl(dimethyl)silyl] 2,2-dimethylbutanedioate (CID 91752559) is bis[tert-butyl(dimethyl)silyl] 2,2-dimethylbutanedioate.
What is the SMILES notation for bis[tert-butyl(dimethyl)silyl] 2,2-dimethylbutanedioate?
The canonical SMILES for bis[tert-butyl(dimethyl)silyl] 2,2-dimethylbutanedioate is CC(C)(CC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of bis[tert-butyl(dimethyl)silyl] 2,2-dimethylbutanedioate?
The InChIKey is IUXVNTDYFCZPOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H38O4Si2/c1-16(2,3)23(9,10)21-14(19)13-18(7,8)15(20)22-24(11,12)17(4,5)6/h13H2,1-12H3.
What are the key properties of bis[tert-butyl(dimethyl)silyl] 2,2-dimethylbutanedioate?
bis[tert-butyl(dimethyl)silyl] 2,2-dimethylbutanedioate has a molecular weight of 374.67 g/mol, XLogP of 5.50, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis[tert-butyl(dimethyl)silyl] 2,2-dimethylbutanedioate is sourced from PubChem (CID 91752559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).