C17H38O3Si2 — CID 91752565
[tert-butyl(dimethyl)silyl] 2-[tert-butyl(dimethyl)silyl]oxy-2-methylbutanoate (PubChem CID 91752565) has the molecular formula C17H38O3Si2 and a molecular weight of 346.66 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] 2-[tert-butyl(dimethyl)silyl]oxy-2-methylbutanoate.
| Compound Name | [tert-butyl(dimethyl)silyl] 2-[tert-butyl(dimethyl)silyl]oxy-2-methylbutanoate |
|---|---|
| PubChem CID | 91752565 |
| Molecular Formula | C17H38O3Si2 |
| Molecular Weight | 346.66 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] 2-[tert-butyl(dimethyl)silyl]oxy-2-methylbutanoate |
| SMILES | CCC(C)(O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H38O3Si2/c1-13-17(8,20-22(11,12)16(5,6)7)14(18)19-21(9,10)15(2,3)4/h13H2,1-12H3 |
| InChIKey | RYDQSIAISKWDKE-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.66 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|