About (8S)-8-(2-phenylethyl)-1,4-dioxocane-2,5-dione
(8S)-8-(2-phenylethyl)-1,4-dioxocane-2,5-dione (PubChem CID 91752676) has the molecular formula C14H16O4
and a molecular weight of 248.28 g/mol. Its IUPAC name is (8S)-8-(2-phenylethyl)-1,4-dioxocane-2,5-dione.
Molecular Properties
| Compound Name | (8S)-8-(2-phenylethyl)-1,4-dioxocane-2,5-dione |
| PubChem CID | 91752676 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | (8S)-8-(2-phenylethyl)-1,4-dioxocane-2,5-dione |
| SMILES | O=C1CC[C@H](CCc2ccccc2)OC(=O)CO1 |
| InChI | InChI=1S/C14H16O4/c15-13-9-8-12(18-14(16)10-17-13)7-6-11-4-2-1-3-5-11/h1-5,12H,6-10H2/t12-/m0/s1 |
| InChIKey | HPTMZEXRPOEIKD-LBPRGKRZSA-N |
| XLogP | 1.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (8S)-8-(2-phenylethyl)-1,4-dioxocane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8S)-8-(2-phenylethyl)-1,4-dioxocane-2,5-dione?
The IUPAC name of (8S)-8-(2-phenylethyl)-1,4-dioxocane-2,5-dione (CID 91752676) is (8S)-8-(2-phenylethyl)-1,4-dioxocane-2,5-dione.
What is the SMILES notation for (8S)-8-(2-phenylethyl)-1,4-dioxocane-2,5-dione?
The canonical SMILES for (8S)-8-(2-phenylethyl)-1,4-dioxocane-2,5-dione is O=C1CC[C@H](CCc2ccccc2)OC(=O)CO1.
What is the InChIKey of (8S)-8-(2-phenylethyl)-1,4-dioxocane-2,5-dione?
The InChIKey is HPTMZEXRPOEIKD-LBPRGKRZSA-N. The full InChI is InChI=1S/C14H16O4/c15-13-9-8-12(18-14(16)10-17-13)7-6-11-4-2-1-3-5-11/h1-5,12H,6-10H2/t12-/m0/s1.
What are the key properties of (8S)-8-(2-phenylethyl)-1,4-dioxocane-2,5-dione?
(8S)-8-(2-phenylethyl)-1,4-dioxocane-2,5-dione has a molecular weight of 248.28 g/mol, XLogP of 1.87, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (8S)-8-(2-phenylethyl)-1,4-dioxocane-2,5-dione is sourced from PubChem (CID 91752676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).