C15H13F3O4 — CID 91752692
(3aS,4S,6aS)-4-[2-[4-(trifluoromethyl)phenyl]ethyl]-3,3a,4,6a-tetrahydrofuro[2,3-c]furan-2,6-dione (PubChem CID 91752692) has the molecular formula C15H13F3O4 and a molecular weight of 314.26 g/mol. Its IUPAC name is (3aS,4S,6aS)-4-[2-[4-(trifluoromethyl)phenyl]ethyl]-3,3a,4,6a-tetrahydrofuro[2,3-c]furan-2,6-dione.
| Compound Name | (3aS,4S,6aS)-4-[2-[4-(trifluoromethyl)phenyl]ethyl]-3,3a,4,6a-tetrahydrofuro[2,3-c]furan-2,6-dione |
|---|---|
| PubChem CID | 91752692 |
| Molecular Formula | C15H13F3O4 |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | (3aS,4S,6aS)-4-[2-[4-(trifluoromethyl)phenyl]ethyl]-3,3a,4,6a-tetrahydrofuro[2,3-c]furan-2,6-dione |
| SMILES | O=C1C[C@H]2[C@H](CCc3ccc(C(F)(F)F)cc3)OC(=O)[C@H]2O1 |
| InChI | InChI=1S/C15H13F3O4/c16-15(17,18)9-4-1-8(2-5-9)3-6-11-10-7-12(19)22-13(10)14(20)21-11/h1-2,4-5,10-11,13H,3,6-7H2/t10-,11-,13-/m0/s1 |
| InChIKey | VOFVQYNCMZIMJI-GVXVVHGQSA-N |
| XLogP | 2.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |