C14H14O4 — CID 91752694
(3aS,4S,6aS)-4-(2-phenylethyl)-3,3a,4,6a-tetrahydrofuro[2,3-c]furan-2,6-dione (PubChem CID 91752694) has the molecular formula C14H14O4 and a molecular weight of 246.26 g/mol. Its IUPAC name is (3aS,4S,6aS)-4-(2-phenylethyl)-3,3a,4,6a-tetrahydrofuro[2,3-c]furan-2,6-dione.
| Compound Name | (3aS,4S,6aS)-4-(2-phenylethyl)-3,3a,4,6a-tetrahydrofuro[2,3-c]furan-2,6-dione |
|---|---|
| PubChem CID | 91752694 |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | (3aS,4S,6aS)-4-(2-phenylethyl)-3,3a,4,6a-tetrahydrofuro[2,3-c]furan-2,6-dione |
| SMILES | O=C1C[C@H]2[C@H](CCc3ccccc3)OC(=O)[C@H]2O1 |
| InChI | InChI=1S/C14H14O4/c15-12-8-10-11(17-14(16)13(10)18-12)7-6-9-4-2-1-3-5-9/h1-5,10-11,13H,6-8H2/t10-,11-,13-/m0/s1 |
| InChIKey | JPDNKTJUDXVCLT-GVXVVHGQSA-N |
| XLogP | 1.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |