C12H12F5NOS — CID 91752798
(Z)-4-methylsulfanyl-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]butan-2-imine (PubChem CID 91752798) has the molecular formula C12H12F5NOS and a molecular weight of 313.29 g/mol. Its IUPAC name is (Z)-4-methylsulfanyl-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]butan-2-imine.
| Compound Name | (Z)-4-methylsulfanyl-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]butan-2-imine |
|---|---|
| PubChem CID | 91752798 |
| Molecular Formula | C12H12F5NOS |
| Molecular Weight | 313.29 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | (Z)-4-methylsulfanyl-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]butan-2-imine |
| SMILES | CSCC/C(C)=N\OCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H12F5NOS/c1-6(3-4-20-2)18-19-5-7-8(13)10(15)12(17)11(16)9(7)14/h3-5H2,1-2H3/b18-6- |
| InChIKey | RZTPUHVTRNLFEF-FXBPXSCXSA-N |
| XLogP | 4.03 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.29 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|