C15H11F5N2O — CID 91752812
2-[(E)-C-methyl-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]carbonimidoyl]aniline (PubChem CID 91752812) has the molecular formula C15H11F5N2O and a molecular weight of 330.26 g/mol. Its IUPAC name is 2-[(E)-C-methyl-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]carbonimidoyl]aniline.
| Compound Name | 2-[(E)-C-methyl-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]carbonimidoyl]aniline |
|---|---|
| PubChem CID | 91752812 |
| Molecular Formula | C15H11F5N2O |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 2-[(E)-C-methyl-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]carbonimidoyl]aniline |
| SMILES | C/C(=N\OCc1c(F)c(F)c(F)c(F)c1F)c1ccccc1N |
| InChI | InChI=1S/C15H11F5N2O/c1-7(8-4-2-3-5-10(8)21)22-23-6-9-11(16)13(18)15(20)14(19)12(9)17/h2-5H,6,21H2,1H3/b22-7+ |
| InChIKey | IMEZFULKLNMRHL-QPJQQBGISA-N |
| XLogP | 3.91 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|