About 7-tert-butyl-1-oxaspiro[4.5]deca-6,9-diene-2,8-dione
7-tert-butyl-1-oxaspiro[4.5]deca-6,9-diene-2,8-dione (PubChem CID 91752841) has the molecular formula C13H16O3
and a molecular weight of 220.27 g/mol. Its IUPAC name is 7-tert-butyl-1-oxaspiro[4.5]deca-6,9-diene-2,8-dione.
Molecular Properties
| Compound Name | 7-tert-butyl-1-oxaspiro[4.5]deca-6,9-diene-2,8-dione |
| PubChem CID | 91752841 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 7-tert-butyl-1-oxaspiro[4.5]deca-6,9-diene-2,8-dione |
| SMILES | CC(C)(C)C1=CC2(C=CC1=O)CCC(=O)O2 |
| InChI | InChI=1S/C13H16O3/c1-12(2,3)9-8-13(6-4-10(9)14)7-5-11(15)16-13/h4,6,8H,5,7H2,1-3H3 |
| InChIKey | IUQXVAIQPMFIGU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-tert-butyl-1-oxaspiro[4.5]deca-6,9-diene-2,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-tert-butyl-1-oxaspiro[4.5]deca-6,9-diene-2,8-dione?
The IUPAC name of 7-tert-butyl-1-oxaspiro[4.5]deca-6,9-diene-2,8-dione (CID 91752841) is 7-tert-butyl-1-oxaspiro[4.5]deca-6,9-diene-2,8-dione.
What is the SMILES notation for 7-tert-butyl-1-oxaspiro[4.5]deca-6,9-diene-2,8-dione?
The canonical SMILES for 7-tert-butyl-1-oxaspiro[4.5]deca-6,9-diene-2,8-dione is CC(C)(C)C1=CC2(C=CC1=O)CCC(=O)O2.
What is the InChIKey of 7-tert-butyl-1-oxaspiro[4.5]deca-6,9-diene-2,8-dione?
The InChIKey is IUQXVAIQPMFIGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O3/c1-12(2,3)9-8-13(6-4-10(9)14)7-5-11(15)16-13/h4,6,8H,5,7H2,1-3H3.
What are the key properties of 7-tert-butyl-1-oxaspiro[4.5]deca-6,9-diene-2,8-dione?
7-tert-butyl-1-oxaspiro[4.5]deca-6,9-diene-2,8-dione has a molecular weight of 220.27 g/mol, XLogP of 2.17, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-tert-butyl-1-oxaspiro[4.5]deca-6,9-diene-2,8-dione is sourced from PubChem (CID 91752841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).