C32H64O5Si4 — CID 91753005
trimethylsilyl (Z)-7-[(1R,2R,3R,5S)-3,5-bis(trimethylsilyloxy)-2-[(1E,3S,5Z)-3-trimethylsilyloxyocta-1,5-dienyl]cyclopentyl]hept-5-enoate (PubChem CID 91753005) has the molecular formula C32H64O5Si4 and a molecular weight of 641.20 g/mol. Its IUPAC name is trimethylsilyl (Z)-7-[(1R,2R,3R,5S)-3,5-bis(trimethylsilyloxy)-2-[(1E,3S,5Z)-3-trimethylsilyloxyocta-1,5-dienyl]cyclopentyl]hept-5-enoate.
| Compound Name | trimethylsilyl (Z)-7-[(1R,2R,3R,5S)-3,5-bis(trimethylsilyloxy)-2-[(1E,3S,5Z)-3-trimethylsilyloxyocta-1,5-dienyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 91753005 |
| Molecular Formula | C32H64O5Si4 |
| Molecular Weight | 641.20 g/mol |
| Exact Mass | 640.38 |
| IUPAC Name | trimethylsilyl (Z)-7-[(1R,2R,3R,5S)-3,5-bis(trimethylsilyloxy)-2-[(1E,3S,5Z)-3-trimethylsilyloxyocta-1,5-dienyl]cyclopentyl]hept-5-enoate |
| SMILES | CC/C=C\C[C@@H](/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C[C@H]1O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C32H64O5Si4/c1-14-15-18-21-27(34-38(2,3)4)24-25-29-28(22-19-16-17-20-23-32(33)37-41(11,12)13)30(35-39(5,6)7)26-31(29)36-40(8,9)10/h15-16,18-19,24-25,27-31H,14,17,20-23,26H2,1-13H3/b18-15-,19-16-,25-24+/t27-,28+,29+,30-,31+/m0/s1 |
| InChIKey | IETWKNBKTVCSBD-YQVNPAJISA-N |
| XLogP | 9.69 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.20 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|