About methyl (3aS,7aR)-2,3,3a,7a-tetrahydro-1H-indene-4-carboxylate
methyl (3aS,7aR)-2,3,3a,7a-tetrahydro-1H-indene-4-carboxylate (PubChem CID 91753197) has the molecular formula C11H14O2
and a molecular weight of 178.23 g/mol. Its IUPAC name is methyl (3aS,7aR)-2,3,3a,7a-tetrahydro-1H-indene-4-carboxylate.
Analyze methyl (3aS,7aR)-2,3,3a,7a-tetrahydro-1H-indene-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3aS,7aR)-2,3,3a,7a-tetrahydro-1H-indene-4-carboxylate?
The IUPAC name of methyl (3aS,7aR)-2,3,3a,7a-tetrahydro-1H-indene-4-carboxylate (CID 91753197) is methyl (3aS,7aR)-2,3,3a,7a-tetrahydro-1H-indene-4-carboxylate.
What is the SMILES notation for methyl (3aS,7aR)-2,3,3a,7a-tetrahydro-1H-indene-4-carboxylate?
The canonical SMILES for methyl (3aS,7aR)-2,3,3a,7a-tetrahydro-1H-indene-4-carboxylate is COC(=O)C1=CC=C[C@H]2CCC[C@H]12.
What is the InChIKey of methyl (3aS,7aR)-2,3,3a,7a-tetrahydro-1H-indene-4-carboxylate?
The InChIKey is ABRJMTSLLBQAHF-BDAKNGLRSA-N. The full InChI is InChI=1S/C11H14O2/c1-13-11(12)10-7-3-5-8-4-2-6-9(8)10/h3,5,7-9H,2,4,6H2,1H3/t8-,9+/m1/s1.
What are the key properties of methyl (3aS,7aR)-2,3,3a,7a-tetrahydro-1H-indene-4-carboxylate?
methyl (3aS,7aR)-2,3,3a,7a-tetrahydro-1H-indene-4-carboxylate has a molecular weight of 178.23 g/mol, XLogP of 2.07, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3aS,7aR)-2,3,3a,7a-tetrahydro-1H-indene-4-carboxylate is sourced from PubChem (CID 91753197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).