C9H15NO — CID 91753264
(8S)-7-(methoxymethyl)-2,3,5,8-tetrahydro-1H-pyrrolizine (PubChem CID 91753264) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is (8S)-7-(methoxymethyl)-2,3,5,8-tetrahydro-1H-pyrrolizine.
| Compound Name | (8S)-7-(methoxymethyl)-2,3,5,8-tetrahydro-1H-pyrrolizine |
|---|---|
| PubChem CID | 91753264 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | (8S)-7-(methoxymethyl)-2,3,5,8-tetrahydro-1H-pyrrolizine |
| SMILES | COCC1=CCN2CCC[C@@H]12 |
| InChI | InChI=1S/C9H15NO/c1-11-7-8-4-6-10-5-2-3-9(8)10/h4,9H,2-3,5-7H2,1H3/t9-/m0/s1 |
| InChIKey | GINGABFMWWPYLM-VIFPVBQESA-N |
| XLogP | 1.04 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|