About 2-hexa-2,4-diynyl-1,6-dioxaspiro[4.4]non-3-ene
2-hexa-2,4-diynyl-1,6-dioxaspiro[4.4]non-3-ene (PubChem CID 91753435) has the molecular formula C13H14O2
and a molecular weight of 202.25 g/mol. Its IUPAC name is 2-hexa-2,4-diynyl-1,6-dioxaspiro[4.4]non-3-ene.
Molecular Properties
| Compound Name | 2-hexa-2,4-diynyl-1,6-dioxaspiro[4.4]non-3-ene |
| PubChem CID | 91753435 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 2-hexa-2,4-diynyl-1,6-dioxaspiro[4.4]non-3-ene |
| SMILES | CC#CC#CCC1C=CC2(CCCO2)O1 |
| InChI | InChI=1S/C13H14O2/c1-2-3-4-5-7-12-8-10-13(15-12)9-6-11-14-13/h8,10,12H,6-7,9,11H2,1H3 |
| InChIKey | NJLYCNZOTQCQMC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-hexa-2,4-diynyl-1,6-dioxaspiro[4.4]non-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hexa-2,4-diynyl-1,6-dioxaspiro[4.4]non-3-ene?
The IUPAC name of 2-hexa-2,4-diynyl-1,6-dioxaspiro[4.4]non-3-ene (CID 91753435) is 2-hexa-2,4-diynyl-1,6-dioxaspiro[4.4]non-3-ene.
What is the SMILES notation for 2-hexa-2,4-diynyl-1,6-dioxaspiro[4.4]non-3-ene?
The canonical SMILES for 2-hexa-2,4-diynyl-1,6-dioxaspiro[4.4]non-3-ene is CC#CC#CCC1C=CC2(CCCO2)O1.
What is the InChIKey of 2-hexa-2,4-diynyl-1,6-dioxaspiro[4.4]non-3-ene?
The InChIKey is NJLYCNZOTQCQMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O2/c1-2-3-4-5-7-12-8-10-13(15-12)9-6-11-14-13/h8,10,12H,6-7,9,11H2,1H3.
What are the key properties of 2-hexa-2,4-diynyl-1,6-dioxaspiro[4.4]non-3-ene?
2-hexa-2,4-diynyl-1,6-dioxaspiro[4.4]non-3-ene has a molecular weight of 202.25 g/mol, XLogP of 1.86, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexa-2,4-diynyl-1,6-dioxaspiro[4.4]non-3-ene is sourced from PubChem (CID 91753435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).