About (6Z)-6-[(Z)-but-2-enylidene]-1,5,5-trimethylcyclohexene
(6Z)-6-[(Z)-but-2-enylidene]-1,5,5-trimethylcyclohexene (PubChem CID 91753566) has the molecular formula C13H20
and a molecular weight of 176.30 g/mol. Its IUPAC name is (6Z)-6-[(Z)-but-2-enylidene]-1,5,5-trimethylcyclohexene.
Molecular Properties
| Compound Name | (6Z)-6-[(Z)-but-2-enylidene]-1,5,5-trimethylcyclohexene |
| PubChem CID | 91753566 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | (6Z)-6-[(Z)-but-2-enylidene]-1,5,5-trimethylcyclohexene |
| SMILES | C/C=C\C=C1/C(C)=CCCC1(C)C |
| InChI | InChI=1S/C13H20/c1-5-6-9-12-11(2)8-7-10-13(12,3)4/h5-6,8-9H,7,10H2,1-4H3/b6-5-,12-9+ |
| InChIKey | BYDQKMZEOZVIJM-ZCRLHDOISA-N |
| XLogP | 4.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (6Z)-6-[(Z)-but-2-enylidene]-1,5,5-trimethylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6Z)-6-[(Z)-but-2-enylidene]-1,5,5-trimethylcyclohexene?
The IUPAC name of (6Z)-6-[(Z)-but-2-enylidene]-1,5,5-trimethylcyclohexene (CID 91753566) is (6Z)-6-[(Z)-but-2-enylidene]-1,5,5-trimethylcyclohexene.
What is the SMILES notation for (6Z)-6-[(Z)-but-2-enylidene]-1,5,5-trimethylcyclohexene?
The canonical SMILES for (6Z)-6-[(Z)-but-2-enylidene]-1,5,5-trimethylcyclohexene is C/C=C\C=C1/C(C)=CCCC1(C)C.
What is the InChIKey of (6Z)-6-[(Z)-but-2-enylidene]-1,5,5-trimethylcyclohexene?
The InChIKey is BYDQKMZEOZVIJM-ZCRLHDOISA-N. The full InChI is InChI=1S/C13H20/c1-5-6-9-12-11(2)8-7-10-13(12,3)4/h5-6,8-9H,7,10H2,1-4H3/b6-5-,12-9+.
What are the key properties of (6Z)-6-[(Z)-but-2-enylidene]-1,5,5-trimethylcyclohexene?
(6Z)-6-[(Z)-but-2-enylidene]-1,5,5-trimethylcyclohexene has a molecular weight of 176.30 g/mol, XLogP of 4.26, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (6Z)-6-[(Z)-but-2-enylidene]-1,5,5-trimethylcyclohexene is sourced from PubChem (CID 91753566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).