C25H46O2Si2 — CID 91753791
[(2S,17R)-10,13-dimethyl-2-trimethylsilyloxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane (PubChem CID 91753791) has the molecular formula C25H46O2Si2 and a molecular weight of 434.81 g/mol. Its IUPAC name is [(2S,17R)-10,13-dimethyl-2-trimethylsilyloxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane.
| Compound Name | [(2S,17R)-10,13-dimethyl-2-trimethylsilyloxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 91753791 |
| Molecular Formula | C25H46O2Si2 |
| Molecular Weight | 434.81 g/mol |
| Exact Mass | 434.30 |
| IUPAC Name | [(2S,17R)-10,13-dimethyl-2-trimethylsilyloxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane |
| SMILES | CC12C[C@@H](O[Si](C)(C)C)CCC1=CCC1C2CCC2(C)C1CC[C@H]2O[Si](C)(C)C |
| InChI | InChI=1S/C25H46O2Si2/c1-24-16-15-22-20(21(24)13-14-23(24)27-29(6,7)8)12-10-18-9-11-19(17-25(18,22)2)26-28(3,4)5/h10,19-23H,9,11-17H2,1-8H3/t19-,20?,21?,22?,23+,24?,25?/m0/s1 |
| InChIKey | XRJBXQOPLLVGGE-WZYQKNPPSA-N |
| XLogP | 7.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.81 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|