About 4-O-[(4-butyl-3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl] 1-O-methyl butanedioate
4-O-[(4-butyl-3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl] 1-O-methyl butanedioate (PubChem CID 91753881) has the molecular formula C25H28N2O6
and a molecular weight of 452.51 g/mol. Its IUPAC name is 4-O-[(4-butyl-3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl] 1-O-methyl butanedioate.
Molecular Properties
| Compound Name | 4-O-[(4-butyl-3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl] 1-O-methyl butanedioate |
| PubChem CID | 91753881 |
| Molecular Formula | C25H28N2O6 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | 4-O-[(4-butyl-3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl] 1-O-methyl butanedioate |
| SMILES | CCCCC1(COC(=O)CCC(=O)OC)C(=O)N(c2ccccc2)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C25H28N2O6/c1-3-4-17-25(18-33-22(29)16-15-21(28)32-2)23(30)26(19-11-7-5-8-12-19)27(24(25)31)20-13-9-6-10-14-20/h5-14H,3-4,15-18H2,1-2H3 |
| InChIKey | BJBCBIVLODJUGN-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4-O-[(4-butyl-3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl] 1-O-methyl butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-[(4-butyl-3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl] 1-O-methyl butanedioate?
The IUPAC name of 4-O-[(4-butyl-3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl] 1-O-methyl butanedioate (CID 91753881) is 4-O-[(4-butyl-3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl] 1-O-methyl butanedioate.
What is the SMILES notation for 4-O-[(4-butyl-3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl] 1-O-methyl butanedioate?
The canonical SMILES for 4-O-[(4-butyl-3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl] 1-O-methyl butanedioate is CCCCC1(COC(=O)CCC(=O)OC)C(=O)N(c2ccccc2)N(c2ccccc2)C1=O.
What is the InChIKey of 4-O-[(4-butyl-3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl] 1-O-methyl butanedioate?
The InChIKey is BJBCBIVLODJUGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H28N2O6/c1-3-4-17-25(18-33-22(29)16-15-21(28)32-2)23(30)26(19-11-7-5-8-12-19)27(24(25)31)20-13-9-6-10-14-20/h5-14H,3-4,15-18H2,1-2H3.
What are the key properties of 4-O-[(4-butyl-3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl] 1-O-methyl butanedioate?
4-O-[(4-butyl-3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl] 1-O-methyl butanedioate has a molecular weight of 452.51 g/mol, XLogP of 3.65, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-[(4-butyl-3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl] 1-O-methyl butanedioate is sourced from PubChem (CID 91753881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).