C23H33NO2Si — CID 91753973
N-methyl-2-phenyl-N-[(1S,2R)-1-phenyl-1-trimethylsilyloxypropan-2-yl]butanamide (PubChem CID 91753973) has the molecular formula C23H33NO2Si and a molecular weight of 383.61 g/mol. Its IUPAC name is N-methyl-2-phenyl-N-[(1S,2R)-1-phenyl-1-trimethylsilyloxypropan-2-yl]butanamide.
| Compound Name | N-methyl-2-phenyl-N-[(1S,2R)-1-phenyl-1-trimethylsilyloxypropan-2-yl]butanamide |
|---|---|
| PubChem CID | 91753973 |
| Molecular Formula | C23H33NO2Si |
| Molecular Weight | 383.61 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | N-methyl-2-phenyl-N-[(1S,2R)-1-phenyl-1-trimethylsilyloxypropan-2-yl]butanamide |
| SMILES | CCC(C(=O)N(C)[C@H](C)[C@@H](O[Si](C)(C)C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H33NO2Si/c1-7-21(19-14-10-8-11-15-19)23(25)24(3)18(2)22(26-27(4,5)6)20-16-12-9-13-17-20/h8-18,21-22H,7H2,1-6H3/t18-,21?,22-/m1/s1 |
| InChIKey | WKCMQVCLOHXYPJ-MCGPBEARSA-N |
| XLogP | 5.62 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.61 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|