C21H38O2Si — CID 91754000
trimethylsilyl (6Z,9Z,12Z)-octadeca-6,9,12-trienoate (PubChem CID 91754000) has the molecular formula C21H38O2Si and a molecular weight of 350.62 g/mol. Its IUPAC name is trimethylsilyl (6Z,9Z,12Z)-octadeca-6,9,12-trienoate.
| Compound Name | trimethylsilyl (6Z,9Z,12Z)-octadeca-6,9,12-trienoate |
|---|---|
| PubChem CID | 91754000 |
| Molecular Formula | C21H38O2Si |
| Molecular Weight | 350.62 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | trimethylsilyl (6Z,9Z,12Z)-octadeca-6,9,12-trienoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCC(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C21H38O2Si/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(22)23-24(2,3)4/h9-10,12-13,15-16H,5-8,11,14,17-20H2,1-4H3/b10-9-,13-12-,16-15- |
| InChIKey | YTIJXHGXJIJZKZ-YOILPLPUSA-N |
| XLogP | 6.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.62 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|