About 5-cyclohexylindol-2-one
5-cyclohexylindol-2-one (PubChem CID 91754974) has the molecular formula C14H15NO
and a molecular weight of 213.28 g/mol. Its IUPAC name is 5-cyclohexylindol-2-one.
Molecular Properties
| Compound Name | 5-cyclohexylindol-2-one |
| PubChem CID | 91754974 |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 5-cyclohexylindol-2-one |
| SMILES | O=C1C=c2cc(C3CCCCC3)ccc2=N1 |
| InChI | InChI=1S/C14H15NO/c16-14-9-12-8-11(6-7-13(12)15-14)10-4-2-1-3-5-10/h6-10H,1-5H2 |
| InChIKey | ZILUCWRWRBRYTR-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-cyclohexylindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclohexylindol-2-one?
The IUPAC name of 5-cyclohexylindol-2-one (CID 91754974) is 5-cyclohexylindol-2-one.
What is the SMILES notation for 5-cyclohexylindol-2-one?
The canonical SMILES for 5-cyclohexylindol-2-one is O=C1C=c2cc(C3CCCCC3)ccc2=N1.
What is the InChIKey of 5-cyclohexylindol-2-one?
The InChIKey is ZILUCWRWRBRYTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO/c16-14-9-12-8-11(6-7-13(12)15-14)10-4-2-1-3-5-10/h6-10H,1-5H2.
What are the key properties of 5-cyclohexylindol-2-one?
5-cyclohexylindol-2-one has a molecular weight of 213.28 g/mol, XLogP of 1.67, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclohexylindol-2-one is sourced from PubChem (CID 91754974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).