About 5-cyclohexylspiro[1H-indole-3,4'-oxane]-2-one
5-cyclohexylspiro[1H-indole-3,4'-oxane]-2-one (PubChem CID 91754990) has the molecular formula C18H23NO2
and a molecular weight of 285.39 g/mol. Its IUPAC name is 5-cyclohexylspiro[1H-indole-3,4'-oxane]-2-one.
Molecular Properties
| Compound Name | 5-cyclohexylspiro[1H-indole-3,4'-oxane]-2-one |
| PubChem CID | 91754990 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 5-cyclohexylspiro[1H-indole-3,4'-oxane]-2-one |
| SMILES | O=C1Nc2ccc(C3CCCCC3)cc2C12CCOCC2 |
| InChI | InChI=1S/C18H23NO2/c20-17-18(8-10-21-11-9-18)15-12-14(6-7-16(15)19-17)13-4-2-1-3-5-13/h6-7,12-13H,1-5,8-11H2,(H,19,20) |
| InChIKey | RZFQOJSXHMJDFD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-cyclohexylspiro[1H-indole-3,4'-oxane]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclohexylspiro[1H-indole-3,4'-oxane]-2-one?
The IUPAC name of 5-cyclohexylspiro[1H-indole-3,4'-oxane]-2-one (CID 91754990) is 5-cyclohexylspiro[1H-indole-3,4'-oxane]-2-one.
What is the SMILES notation for 5-cyclohexylspiro[1H-indole-3,4'-oxane]-2-one?
The canonical SMILES for 5-cyclohexylspiro[1H-indole-3,4'-oxane]-2-one is O=C1Nc2ccc(C3CCCCC3)cc2C12CCOCC2.
What is the InChIKey of 5-cyclohexylspiro[1H-indole-3,4'-oxane]-2-one?
The InChIKey is RZFQOJSXHMJDFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23NO2/c20-17-18(8-10-21-11-9-18)15-12-14(6-7-16(15)19-17)13-4-2-1-3-5-13/h6-7,12-13H,1-5,8-11H2,(H,19,20).
What are the key properties of 5-cyclohexylspiro[1H-indole-3,4'-oxane]-2-one?
5-cyclohexylspiro[1H-indole-3,4'-oxane]-2-one has a molecular weight of 285.39 g/mol, XLogP of 3.73, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclohexylspiro[1H-indole-3,4'-oxane]-2-one is sourced from PubChem (CID 91754990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).