C30H29F2N5O6 — CID 91755049
N-[(3R,4R)-4-[[4-[2,3-difluoro-6-[2-(2-hydroxyethoxy)ethoxy]benzoyl]benzoyl]amino]pyrrolidin-3-yl]-1H-indazole-6-carboxamide (PubChem CID 91755049) has the molecular formula C30H29F2N5O6 and a molecular weight of 593.59 g/mol. Its IUPAC name is N-[(3R,4R)-4-[[4-[2,3-difluoro-6-[2-(2-hydroxyethoxy)ethoxy]benzoyl]benzoyl]amino]pyrrolidin-3-yl]-1H-indazole-6-carboxamide.
| Compound Name | N-[(3R,4R)-4-[[4-[2,3-difluoro-6-[2-(2-hydroxyethoxy)ethoxy]benzoyl]benzoyl]amino]pyrrolidin-3-yl]-1H-indazole-6-carboxamide |
|---|---|
| PubChem CID | 91755049 |
| Molecular Formula | C30H29F2N5O6 |
| Molecular Weight | 593.59 g/mol |
| Exact Mass | 593.21 |
| IUPAC Name | N-[(3R,4R)-4-[[4-[2,3-difluoro-6-[2-(2-hydroxyethoxy)ethoxy]benzoyl]benzoyl]amino]pyrrolidin-3-yl]-1H-indazole-6-carboxamide |
| SMILES | O=C(N[C@@H]1CNC[C@H]1NC(=O)c1ccc2cn[nH]c2c1)c1ccc(C(=O)c2c(OCCOCCO)ccc(F)c2F)cc1 |
| InChI | InChI=1S/C30H29F2N5O6/c31-21-7-8-25(43-12-11-42-10-9-38)26(27(21)32)28(39)17-1-3-18(4-2-17)29(40)35-23-15-33-16-24(23)36-30(41)19-5-6-20-14-34-37-22(20)13-19/h1-8,13-14,23-24,33,38H,9-12,15-16H2,(H,34,37)(H,35,40)(H,36,41)/t23-,24-/m1/s1 |
| InChIKey | XOCCNERWUVJJTB-DNQXCXABSA-N |
| XLogP | 1.96 |
| TPSA | 154.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.59 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|