C15H19FN2O — CID 91755802
5-fluoro-N,N-di(propan-2-yl)-1H-indole-3-carboxamide (PubChem CID 91755802) has the molecular formula C15H19FN2O and a molecular weight of 262.33 g/mol. Its IUPAC name is 5-fluoro-N,N-di(propan-2-yl)-1H-indole-3-carboxamide.
| Compound Name | 5-fluoro-N,N-di(propan-2-yl)-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 91755802 |
| Molecular Formula | C15H19FN2O |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 5-fluoro-N,N-di(propan-2-yl)-1H-indole-3-carboxamide |
| SMILES | CC(C)N(C(=O)c1c[nH]c2ccc(F)cc12)C(C)C |
| InChI | InChI=1S/C15H19FN2O/c1-9(2)18(10(3)4)15(19)13-8-17-14-6-5-11(16)7-12(13)14/h5-10,17H,1-4H3 |
| InChIKey | YYWKFWIHNRBSGK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |