C6H5FN2O — CID 91757198
7-fluoro-5H-imidazo[2,1-b][1,3]oxazine (PubChem CID 91757198) has the molecular formula C6H5FN2O and a molecular weight of 140.12 g/mol. Its IUPAC name is 7-fluoro-5H-imidazo[2,1-b][1,3]oxazine.
| Compound Name | 7-fluoro-5H-imidazo[2,1-b][1,3]oxazine |
|---|---|
| PubChem CID | 91757198 |
| Molecular Formula | C6H5FN2O |
| Molecular Weight | 140.12 g/mol |
| Exact Mass | 140.04 |
| IUPAC Name | 7-fluoro-5H-imidazo[2,1-b][1,3]oxazine |
| SMILES | FC1=CCn2ccnc2O1 |
| InChI | InChI=1S/C6H5FN2O/c7-5-1-3-9-4-2-8-6(9)10-5/h1-2,4H,3H2 |
| InChIKey | HMRAEDMIQHERPU-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.12 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |