C15H17IN2O — CID 91757468
3-(2-iodophenyl)-6,6-dimethyl-3a,5,7,7a-tetrahydro-1H-indazol-4-one (PubChem CID 91757468) has the molecular formula C15H17IN2O and a molecular weight of 368.22 g/mol. Its IUPAC name is 3-(2-iodophenyl)-6,6-dimethyl-3a,5,7,7a-tetrahydro-1H-indazol-4-one.
| Compound Name | 3-(2-iodophenyl)-6,6-dimethyl-3a,5,7,7a-tetrahydro-1H-indazol-4-one |
|---|---|
| PubChem CID | 91757468 |
| Molecular Formula | C15H17IN2O |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | 3-(2-iodophenyl)-6,6-dimethyl-3a,5,7,7a-tetrahydro-1H-indazol-4-one |
| SMILES | CC1(C)CC(=O)C2C(c3ccccc3I)=NNC2C1 |
| InChI | InChI=1S/C15H17IN2O/c1-15(2)7-11-13(12(19)8-15)14(18-17-11)9-5-3-4-6-10(9)16/h3-6,11,13,17H,7-8H2,1-2H3 |
| InChIKey | QPKQTMZTJASVEJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|