C20H27FN3O11P — CID 91757942
(2S)-2-[[[(2S)-2-carboxy-2-[[(2S)-2-[(4-fluorobenzoyl)amino]-3-methylbutanoyl]amino]ethoxy]-hydroxyphosphoryl]amino]pentanedioic acid (PubChem CID 91757942) has the molecular formula C20H27FN3O11P and a molecular weight of 535.42 g/mol. Its IUPAC name is (2S)-2-[[[(2S)-2-carboxy-2-[[(2S)-2-[(4-fluorobenzoyl)amino]-3-methylbutanoyl]amino]ethoxy]-hydroxyphosphoryl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[[(2S)-2-carboxy-2-[[(2S)-2-[(4-fluorobenzoyl)amino]-3-methylbutanoyl]amino]ethoxy]-hydroxyphosphoryl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 91757942 |
| Molecular Formula | C20H27FN3O11P |
| Molecular Weight | 535.42 g/mol |
| Exact Mass | 535.14 |
| IUPAC Name | (2S)-2-[[[(2S)-2-carboxy-2-[[(2S)-2-[(4-fluorobenzoyl)amino]-3-methylbutanoyl]amino]ethoxy]-hydroxyphosphoryl]amino]pentanedioic acid |
| SMILES | CC(C)[C@H](NC(=O)c1ccc(F)cc1)C(=O)N[C@@H](COP(=O)(O)N[C@@H](CCC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C20H27FN3O11P/c1-10(2)16(23-17(27)11-3-5-12(21)6-4-11)18(28)22-14(20(31)32)9-35-36(33,34)24-13(19(29)30)7-8-15(25)26/h3-6,10,13-14,16H,7-9H2,1-2H3,(H,22,28)(H,23,27)(H,25,26)(H,29,30)(H,31,32)(H2,24,33,34)/t13-,14-,16-/m0/s1 |
| InChIKey | OEWFGJXRSPYZTR-DZKIICNBSA-N |
| XLogP | 0.17 |
| TPSA | 228.66 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.42 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|