C18H14F5N5O2 — CID 91758322
N'-(5-fluoro-6-methoxy-3-pyridinyl)-3-(4-fluorophenyl)-1-(2,2,2-trifluoroethyl)pyrazole-5-carbohydrazide (PubChem CID 91758322) has the molecular formula C18H14F5N5O2 and a molecular weight of 427.33 g/mol. Its IUPAC name is N'-(5-fluoro-6-methoxy-3-pyridinyl)-3-(4-fluorophenyl)-1-(2,2,2-trifluoroethyl)pyrazole-5-carbohydrazide.
| Compound Name | N'-(5-fluoro-6-methoxy-3-pyridinyl)-3-(4-fluorophenyl)-1-(2,2,2-trifluoroethyl)pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 91758322 |
| Molecular Formula | C18H14F5N5O2 |
| Molecular Weight | 427.33 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | N'-(5-fluoro-6-methoxy-3-pyridinyl)-3-(4-fluorophenyl)-1-(2,2,2-trifluoroethyl)pyrazole-5-carbohydrazide |
| SMILES | COc1ncc(NNC(=O)c2cc(-c3ccc(F)cc3)nn2CC(F)(F)F)cc1F |
| InChI | InChI=1S/C18H14F5N5O2/c1-30-17-13(20)6-12(8-24-17)25-26-16(29)15-7-14(10-2-4-11(19)5-3-10)27-28(15)9-18(21,22)23/h2-8,25H,9H2,1H3,(H,26,29) |
| InChIKey | MTAJIAYYZGNOIC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|