C14H16O5 — CID 91758442
(1R,2S,9R)-2,7-dimethyl-4,8,12-trioxatetracyclo[7.3.3.01,9.02,6]pentadec-6-ene-5,11-dione (PubChem CID 91758442) has the molecular formula C14H16O5 and a molecular weight of 264.28 g/mol. Its IUPAC name is (1R,2S,9R)-2,7-dimethyl-4,8,12-trioxatetracyclo[7.3.3.01,9.02,6]pentadec-6-ene-5,11-dione.
| Compound Name | (1R,2S,9R)-2,7-dimethyl-4,8,12-trioxatetracyclo[7.3.3.01,9.02,6]pentadec-6-ene-5,11-dione |
|---|---|
| PubChem CID | 91758442 |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | (1R,2S,9R)-2,7-dimethyl-4,8,12-trioxatetracyclo[7.3.3.01,9.02,6]pentadec-6-ene-5,11-dione |
| SMILES | CC1=C2C(=O)OC[C@@]2(C)[C@]23CCC[C@]2(CC(=O)O3)O1 |
| InChI | InChI=1S/C14H16O5/c1-8-10-11(16)17-7-12(10,2)14-5-3-4-13(14,18-8)6-9(15)19-14/h3-7H2,1-2H3/t12-,13-,14-/m1/s1 |
| InChIKey | GSLMDSYIKPBPAJ-MGPQQGTHSA-N |
| XLogP | 1.46 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |