C18H38O4Si2 — CID 91758703
[(3S,3aS,6R,6aS)-3-triethylsilyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy-triethylsilane (PubChem CID 91758703) has the molecular formula C18H38O4Si2 and a molecular weight of 374.67 g/mol. Its IUPAC name is [(3S,3aS,6R,6aS)-3-triethylsilyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy-triethylsilane.
| Compound Name | [(3S,3aS,6R,6aS)-3-triethylsilyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 91758703 |
| Molecular Formula | C18H38O4Si2 |
| Molecular Weight | 374.67 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | [(3S,3aS,6R,6aS)-3-triethylsilyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)O[C@H]1CO[C@H]2[C@@H]1OC[C@H]2O[Si](CC)(CC)CC |
| InChI | InChI=1S/C18H38O4Si2/c1-7-23(8-2,9-3)21-15-13-19-18-16(14-20-17(15)18)22-24(10-4,11-5)12-6/h15-18H,7-14H2,1-6H3/t15-,16+,17-,18-/m1/s1 |
| InChIKey | MKRYLAIESKPNPB-XMTFNYHQSA-N |
| XLogP | 4.56 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.67 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|