C12H26O4Si — CID 91758719
(3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(1S)-1-hydroxyethyl]oxolan-3-ol (PubChem CID 91758719) has the molecular formula C12H26O4Si and a molecular weight of 262.42 g/mol. Its IUPAC name is (3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(1S)-1-hydroxyethyl]oxolan-3-ol.
| Compound Name | (3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(1S)-1-hydroxyethyl]oxolan-3-ol |
|---|---|
| PubChem CID | 91758719 |
| Molecular Formula | C12H26O4Si |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | (3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(1S)-1-hydroxyethyl]oxolan-3-ol |
| SMILES | C[C@H](O)[C@H]1OC[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H26O4Si/c1-8(13)10-11(9(14)7-15-10)16-17(5,6)12(2,3)4/h8-11,13-14H,7H2,1-6H3/t8-,9+,10+,11+/m0/s1 |
| InChIKey | VCVASIBZZPKNEH-LNFKQOIKSA-N |
| XLogP | 1.52 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|