C22H31N3O8 — CID 91758768
(1S,3S,5S)-2-[(2S)-2-amino-2-[(5S,7R)-3-hydroxy-1-adamantyl]acetyl]-2-azabicyclo[3.1.0]hexane-3-carbonitrile;(2R,3R)-2,3-dihydroxybutanedioic acid (PubChem CID 91758768) has the molecular formula C22H31N3O8 and a molecular weight of 465.50 g/mol. Its IUPAC name is (1S,3S,5S)-2-[(2S)-2-amino-2-[(5S,7R)-3-hydroxy-1-adamantyl]acetyl]-2-azabicyclo[3.1.0]hexane-3-carbonitrile;(2R,3R)-2,3-dihydroxybutanedioic acid.
| Compound Name | (1S,3S,5S)-2-[(2S)-2-amino-2-[(5S,7R)-3-hydroxy-1-adamantyl]acetyl]-2-azabicyclo[3.1.0]hexane-3-carbonitrile;(2R,3R)-2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 91758768 |
| Molecular Formula | C22H31N3O8 |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | (1S,3S,5S)-2-[(2S)-2-amino-2-[(5S,7R)-3-hydroxy-1-adamantyl]acetyl]-2-azabicyclo[3.1.0]hexane-3-carbonitrile;(2R,3R)-2,3-dihydroxybutanedioic acid |
| SMILES | N#C[C@@H]1C[C@@H]2C[C@@H]2N1C(=O)[C@@H](N)C12C[C@@H]3C[C@@H](CC(O)(C3)C1)C2.O=C(O)[C@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C18H25N3O2.C4H6O6/c19-8-13-2-12-3-14(12)21(13)16(22)15(20)17-4-10-1-11(5-17)7-18(23,6-10)9-17;5-1(3(7)8)2(6)4(9)10/h10-15,23H,1-7,9,20H2;1-2,5-6H,(H,7,8)(H,9,10)/t10-,11+,12-,13+,14+,15-,17?,18?;1-,2-/m11/s1 |
| InChIKey | CQZBYAJKJHBKRS-KUZZENHPSA-N |
| XLogP | -0.96 |
| TPSA | 205.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |