(Z)-4,4,5,5,6,6,6-heptafluoro-3-phenylhex-2-enoic acid

C12H7F7O2 — CID 91758823

IUPAC(Z)-4,4,5,5,6,6,6-heptafluoro-3-phenylhex-2-enoic acid
SMILESO=C(O)/C=C(/c1ccccc1)C(F)(F)C(F)(F)C(F)(F)F
InChIInChI=1S/C12H7F7O2/c13-10(14,11(15,16)12(17,18)19)8(6-9(20)21)7-4-2-1-3-5-7/h1-6H,(H,20,21)/b8-6-
InChIKeyKBXCBBOPXFWBOU-VURMDHGXSA-N
MW316.17 g/mol
LogP3.99
Rot. Bonds4

About (Z)-4,4,5,5,6,6,6-heptafluoro-3-phenylhex-2-enoic acid

(Z)-4,4,5,5,6,6,6-heptafluoro-3-phenylhex-2-enoic acid (PubChem CID 91758823) has the molecular formula C12H7F7O2 and a molecular weight of 316.17 g/mol. Its IUPAC name is (Z)-4,4,5,5,6,6,6-heptafluoro-3-phenylhex-2-enoic acid.

Molecular Properties

Compound Name(Z)-4,4,5,5,6,6,6-heptafluoro-3-phenylhex-2-enoic acid
PubChem CID91758823
Molecular FormulaC12H7F7O2
Molecular Weight316.17 g/mol
Exact Mass316.03
IUPAC Name(Z)-4,4,5,5,6,6,6-heptafluoro-3-phenylhex-2-enoic acid
SMILESO=C(O)/C=C(/c1ccccc1)C(F)(F)C(F)(F)C(F)(F)F
InChIInChI=1S/C12H7F7O2/c13-10(14,11(15,16)12(17,18)19)8(6-9(20)21)7-4-2-1-3-5-7/h1-6H,(H,20,21)/b8-6-
InChIKeyKBXCBBOPXFWBOU-VURMDHGXSA-N
XLogP3.99
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500316.17
LogP ≤ 53.99
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}

Analyze (Z)-4,4,5,5,6,6,6-heptafluoro-3-phenylhex-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (Z)-4,4,5,5,6,6,6-heptafluoro-3-phenylhex-2-enoic acid?
The IUPAC name of (Z)-4,4,5,5,6,6,6-heptafluoro-3-phenylhex-2-enoic acid (CID 91758823) is (Z)-4,4,5,5,6,6,6-heptafluoro-3-phenylhex-2-enoic acid.
What is the SMILES notation for (Z)-4,4,5,5,6,6,6-heptafluoro-3-phenylhex-2-enoic acid?
The canonical SMILES for (Z)-4,4,5,5,6,6,6-heptafluoro-3-phenylhex-2-enoic acid is O=C(O)/C=C(/c1ccccc1)C(F)(F)C(F)(F)C(F)(F)F.
What is the InChIKey of (Z)-4,4,5,5,6,6,6-heptafluoro-3-phenylhex-2-enoic acid?
The InChIKey is KBXCBBOPXFWBOU-VURMDHGXSA-N. The full InChI is InChI=1S/C12H7F7O2/c13-10(14,11(15,16)12(17,18)19)8(6-9(20)21)7-4-2-1-3-5-7/h1-6H,(H,20,21)/b8-6-.
What are the key properties of (Z)-4,4,5,5,6,6,6-heptafluoro-3-phenylhex-2-enoic acid?
(Z)-4,4,5,5,6,6,6-heptafluoro-3-phenylhex-2-enoic acid has a molecular weight of 316.17 g/mol, XLogP of 3.99, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4,4,5,5,6,6,6-heptafluoro-3-phenylhex-2-enoic acid is sourced from PubChem (CID 91758823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).