[4-fluoro-2-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid

C9H9BF4O3 — CID 91758876

IUPAC[4-fluoro-2-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid
SMILESOB(O)c1ccc(F)cc1COCC(F)(F)F
InChIInChI=1S/C9H9BF4O3/c11-7-1-2-8(10(15)16)6(3-7)4-17-5-9(12,13)14/h1-3,15-16H,4-5H2
InChIKeyCBBVKMAXTUHNQM-UHFFFAOYSA-N
MW251.97 g/mol
LogP0.58
Rot. Bonds4

About [4-fluoro-2-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid

[4-fluoro-2-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid (PubChem CID 91758876) has the molecular formula C9H9BF4O3 and a molecular weight of 251.97 g/mol. Its IUPAC name is [4-fluoro-2-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid.

Molecular Properties

Compound Name[4-fluoro-2-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid
PubChem CID91758876
Molecular FormulaC9H9BF4O3
Molecular Weight251.97 g/mol
Exact Mass252.06
IUPAC Name[4-fluoro-2-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid
SMILESOB(O)c1ccc(F)cc1COCC(F)(F)F
InChIInChI=1S/C9H9BF4O3/c11-7-1-2-8(10(15)16)6(3-7)4-17-5-9(12,13)14/h1-3,15-16H,4-5H2
InChIKeyCBBVKMAXTUHNQM-UHFFFAOYSA-N
XLogP0.58
TPSA49.69 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.97
LogP ≤ 50.58
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [4-fluoro-2-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [4-fluoro-2-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid?
The IUPAC name of [4-fluoro-2-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid (CID 91758876) is [4-fluoro-2-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid.
What is the SMILES notation for [4-fluoro-2-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid?
The canonical SMILES for [4-fluoro-2-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid is OB(O)c1ccc(F)cc1COCC(F)(F)F.
What is the InChIKey of [4-fluoro-2-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid?
The InChIKey is CBBVKMAXTUHNQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BF4O3/c11-7-1-2-8(10(15)16)6(3-7)4-17-5-9(12,13)14/h1-3,15-16H,4-5H2.
What are the key properties of [4-fluoro-2-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid?
[4-fluoro-2-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid has a molecular weight of 251.97 g/mol, XLogP of 0.58, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-fluoro-2-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid is sourced from PubChem (CID 91758876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).