About [4-fluoro-2-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid
[4-fluoro-2-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid (PubChem CID 91758876) has the molecular formula C9H9BF4O3
and a molecular weight of 251.97 g/mol. Its IUPAC name is [4-fluoro-2-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid.
Molecular Properties
| Compound Name | [4-fluoro-2-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid |
| PubChem CID | 91758876 |
| Molecular Formula | C9H9BF4O3 |
| Molecular Weight | 251.97 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | [4-fluoro-2-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid |
| SMILES | OB(O)c1ccc(F)cc1COCC(F)(F)F |
| InChI | InChI=1S/C9H9BF4O3/c11-7-1-2-8(10(15)16)6(3-7)4-17-5-9(12,13)14/h1-3,15-16H,4-5H2 |
| InChIKey | CBBVKMAXTUHNQM-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.97 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [4-fluoro-2-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-fluoro-2-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid?
The IUPAC name of [4-fluoro-2-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid (CID 91758876) is [4-fluoro-2-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid.
What is the SMILES notation for [4-fluoro-2-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid?
The canonical SMILES for [4-fluoro-2-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid is OB(O)c1ccc(F)cc1COCC(F)(F)F.
What is the InChIKey of [4-fluoro-2-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid?
The InChIKey is CBBVKMAXTUHNQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BF4O3/c11-7-1-2-8(10(15)16)6(3-7)4-17-5-9(12,13)14/h1-3,15-16H,4-5H2.
What are the key properties of [4-fluoro-2-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid?
[4-fluoro-2-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid has a molecular weight of 251.97 g/mol, XLogP of 0.58, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-fluoro-2-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid is sourced from PubChem (CID 91758876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).