C10H16F3NO3 — CID 91759742
4,4,4-trifluoro-N-[(3S,4R)-3-methoxyoxan-4-yl]butanamide (PubChem CID 91759742) has the molecular formula C10H16F3NO3 and a molecular weight of 255.24 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-[(3S,4R)-3-methoxyoxan-4-yl]butanamide.
| Compound Name | 4,4,4-trifluoro-N-[(3S,4R)-3-methoxyoxan-4-yl]butanamide |
|---|---|
| PubChem CID | 91759742 |
| Molecular Formula | C10H16F3NO3 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 4,4,4-trifluoro-N-[(3S,4R)-3-methoxyoxan-4-yl]butanamide |
| SMILES | CO[C@@H]1COCC[C@H]1NC(=O)CCC(F)(F)F |
| InChI | InChI=1S/C10H16F3NO3/c1-16-8-6-17-5-3-7(8)14-9(15)2-4-10(11,12)13/h7-8H,2-6H2,1H3,(H,14,15)/t7-,8-/m1/s1 |
| InChIKey | SDOBTZVWFVFRJD-HTQZYQBOSA-N |
| XLogP | 1.25 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |