About 1-[(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-3-[(4-fluorophenyl)methylsulfanyl]propan-1-one
1-[(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-3-[(4-fluorophenyl)methylsulfanyl]propan-1-one (PubChem CID 91760096) has the molecular formula C16H22FNO3S
and a molecular weight of 327.42 g/mol. Its IUPAC name is 1-[(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-3-[(4-fluorophenyl)methylsulfanyl]propan-1-one.
Molecular Properties
| Compound Name | 1-[(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-3-[(4-fluorophenyl)methylsulfanyl]propan-1-one |
| PubChem CID | 91760096 |
| Molecular Formula | C16H22FNO3S |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 1-[(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-3-[(4-fluorophenyl)methylsulfanyl]propan-1-one |
| SMILES | CCO[C@H]1CN(C(=O)CCSCc2ccc(F)cc2)C[C@@H]1O |
| InChI | InChI=1S/C16H22FNO3S/c1-2-21-15-10-18(9-14(15)19)16(20)7-8-22-11-12-3-5-13(17)6-4-12/h3-6,14-15,19H,2,7-11H2,1H3/t14-,15-/m0/s1 |
| InChIKey | VXSBOTWZHHOVOM-GJZGRUSLSA-N |
| XLogP | 2.06 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-3-[(4-fluorophenyl)methylsulfanyl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-3-[(4-fluorophenyl)methylsulfanyl]propan-1-one?
The IUPAC name of 1-[(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-3-[(4-fluorophenyl)methylsulfanyl]propan-1-one (CID 91760096) is 1-[(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-3-[(4-fluorophenyl)methylsulfanyl]propan-1-one.
What is the SMILES notation for 1-[(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-3-[(4-fluorophenyl)methylsulfanyl]propan-1-one?
The canonical SMILES for 1-[(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-3-[(4-fluorophenyl)methylsulfanyl]propan-1-one is CCO[C@H]1CN(C(=O)CCSCc2ccc(F)cc2)C[C@@H]1O.
What is the InChIKey of 1-[(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-3-[(4-fluorophenyl)methylsulfanyl]propan-1-one?
The InChIKey is VXSBOTWZHHOVOM-GJZGRUSLSA-N. The full InChI is InChI=1S/C16H22FNO3S/c1-2-21-15-10-18(9-14(15)19)16(20)7-8-22-11-12-3-5-13(17)6-4-12/h3-6,14-15,19H,2,7-11H2,1H3/t14-,15-/m0/s1.
What are the key properties of 1-[(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-3-[(4-fluorophenyl)methylsulfanyl]propan-1-one?
1-[(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-3-[(4-fluorophenyl)methylsulfanyl]propan-1-one has a molecular weight of 327.42 g/mol, XLogP of 2.06, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-3-[(4-fluorophenyl)methylsulfanyl]propan-1-one is sourced from PubChem (CID 91760096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).