C14H16FN3O2S — CID 91760142
3-fluoro-N-[(3S,4R)-3-(1,3-thiazol-4-ylmethoxy)oxan-4-yl]pyridin-4-amine (PubChem CID 91760142) has the molecular formula C14H16FN3O2S and a molecular weight of 309.37 g/mol. Its IUPAC name is 3-fluoro-N-[(3S,4R)-3-(1,3-thiazol-4-ylmethoxy)oxan-4-yl]pyridin-4-amine.
| Compound Name | 3-fluoro-N-[(3S,4R)-3-(1,3-thiazol-4-ylmethoxy)oxan-4-yl]pyridin-4-amine |
|---|---|
| PubChem CID | 91760142 |
| Molecular Formula | C14H16FN3O2S |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 3-fluoro-N-[(3S,4R)-3-(1,3-thiazol-4-ylmethoxy)oxan-4-yl]pyridin-4-amine |
| SMILES | Fc1cnccc1N[C@@H]1CCOC[C@H]1OCc1cscn1 |
| InChI | InChI=1S/C14H16FN3O2S/c15-11-5-16-3-1-12(11)18-13-2-4-19-7-14(13)20-6-10-8-21-9-17-10/h1,3,5,8-9,13-14H,2,4,6-7H2,(H,16,18)/t13-,14-/m1/s1 |
| InChIKey | RZUQCKVYWZQTBJ-ZIAGYGMSSA-N |
| XLogP | 2.46 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |