About 2-cyclopropyl-N-[(3R,4R)-4-hydroxyoxan-3-yl]-6-oxo-1H-pyrimidine-5-carboxamide
2-cyclopropyl-N-[(3R,4R)-4-hydroxyoxan-3-yl]-6-oxo-1H-pyrimidine-5-carboxamide (PubChem CID 91760242) has the molecular formula C13H17N3O4
and a molecular weight of 279.30 g/mol. Its IUPAC name is 2-cyclopropyl-N-[(3R,4R)-4-hydroxyoxan-3-yl]-6-oxo-1H-pyrimidine-5-carboxamide.
Molecular Properties
| Compound Name | 2-cyclopropyl-N-[(3R,4R)-4-hydroxyoxan-3-yl]-6-oxo-1H-pyrimidine-5-carboxamide |
| PubChem CID | 91760242 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 2-cyclopropyl-N-[(3R,4R)-4-hydroxyoxan-3-yl]-6-oxo-1H-pyrimidine-5-carboxamide |
| SMILES | O=C(N[C@@H]1COCC[C@H]1O)c1cnc(C2CC2)[nH]c1=O |
| InChI | InChI=1S/C13H17N3O4/c17-10-3-4-20-6-9(10)15-12(18)8-5-14-11(7-1-2-7)16-13(8)19/h5,7,9-10,17H,1-4,6H2,(H,15,18)(H,14,16,19)/t9-,10-/m1/s1 |
| InChIKey | ODTLBKCKRITESE-NXEZZACHSA-N |
| XLogP | -0.47 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-cyclopropyl-N-[(3R,4R)-4-hydroxyoxan-3-yl]-6-oxo-1H-pyrimidine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-N-[(3R,4R)-4-hydroxyoxan-3-yl]-6-oxo-1H-pyrimidine-5-carboxamide?
The IUPAC name of 2-cyclopropyl-N-[(3R,4R)-4-hydroxyoxan-3-yl]-6-oxo-1H-pyrimidine-5-carboxamide (CID 91760242) is 2-cyclopropyl-N-[(3R,4R)-4-hydroxyoxan-3-yl]-6-oxo-1H-pyrimidine-5-carboxamide.
What is the SMILES notation for 2-cyclopropyl-N-[(3R,4R)-4-hydroxyoxan-3-yl]-6-oxo-1H-pyrimidine-5-carboxamide?
The canonical SMILES for 2-cyclopropyl-N-[(3R,4R)-4-hydroxyoxan-3-yl]-6-oxo-1H-pyrimidine-5-carboxamide is O=C(N[C@@H]1COCC[C@H]1O)c1cnc(C2CC2)[nH]c1=O.
What is the InChIKey of 2-cyclopropyl-N-[(3R,4R)-4-hydroxyoxan-3-yl]-6-oxo-1H-pyrimidine-5-carboxamide?
The InChIKey is ODTLBKCKRITESE-NXEZZACHSA-N. The full InChI is InChI=1S/C13H17N3O4/c17-10-3-4-20-6-9(10)15-12(18)8-5-14-11(7-1-2-7)16-13(8)19/h5,7,9-10,17H,1-4,6H2,(H,15,18)(H,14,16,19)/t9-,10-/m1/s1.
What are the key properties of 2-cyclopropyl-N-[(3R,4R)-4-hydroxyoxan-3-yl]-6-oxo-1H-pyrimidine-5-carboxamide?
2-cyclopropyl-N-[(3R,4R)-4-hydroxyoxan-3-yl]-6-oxo-1H-pyrimidine-5-carboxamide has a molecular weight of 279.30 g/mol, XLogP of -0.47, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-N-[(3R,4R)-4-hydroxyoxan-3-yl]-6-oxo-1H-pyrimidine-5-carboxamide is sourced from PubChem (CID 91760242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).