About N-[(3S,4R)-3-ethoxyoxan-4-yl]quinoxalin-2-amine
N-[(3S,4R)-3-ethoxyoxan-4-yl]quinoxalin-2-amine (PubChem CID 91760488) has the molecular formula C15H19N3O2
and a molecular weight of 273.34 g/mol. Its IUPAC name is N-[(3S,4R)-3-ethoxyoxan-4-yl]quinoxalin-2-amine.
Molecular Properties
| Compound Name | N-[(3S,4R)-3-ethoxyoxan-4-yl]quinoxalin-2-amine |
| PubChem CID | 91760488 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | N-[(3S,4R)-3-ethoxyoxan-4-yl]quinoxalin-2-amine |
| SMILES | CCO[C@@H]1COCC[C@H]1Nc1cnc2ccccc2n1 |
| InChI | InChI=1S/C15H19N3O2/c1-2-20-14-10-19-8-7-13(14)18-15-9-16-11-5-3-4-6-12(11)17-15/h3-6,9,13-14H,2,7-8,10H2,1H3,(H,17,18)/t13-,14-/m1/s1 |
| InChIKey | PNIDBQVGLWGUJK-ZIAGYGMSSA-N |
| XLogP | 2.24 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(3S,4R)-3-ethoxyoxan-4-yl]quinoxalin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S,4R)-3-ethoxyoxan-4-yl]quinoxalin-2-amine?
The IUPAC name of N-[(3S,4R)-3-ethoxyoxan-4-yl]quinoxalin-2-amine (CID 91760488) is N-[(3S,4R)-3-ethoxyoxan-4-yl]quinoxalin-2-amine.
What is the SMILES notation for N-[(3S,4R)-3-ethoxyoxan-4-yl]quinoxalin-2-amine?
The canonical SMILES for N-[(3S,4R)-3-ethoxyoxan-4-yl]quinoxalin-2-amine is CCO[C@@H]1COCC[C@H]1Nc1cnc2ccccc2n1.
What is the InChIKey of N-[(3S,4R)-3-ethoxyoxan-4-yl]quinoxalin-2-amine?
The InChIKey is PNIDBQVGLWGUJK-ZIAGYGMSSA-N. The full InChI is InChI=1S/C15H19N3O2/c1-2-20-14-10-19-8-7-13(14)18-15-9-16-11-5-3-4-6-12(11)17-15/h3-6,9,13-14H,2,7-8,10H2,1H3,(H,17,18)/t13-,14-/m1/s1.
What are the key properties of N-[(3S,4R)-3-ethoxyoxan-4-yl]quinoxalin-2-amine?
N-[(3S,4R)-3-ethoxyoxan-4-yl]quinoxalin-2-amine has a molecular weight of 273.34 g/mol, XLogP of 2.24, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S,4R)-3-ethoxyoxan-4-yl]quinoxalin-2-amine is sourced from PubChem (CID 91760488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).