About 2-cyclopropyl-N-[(3S,4R)-3-(2-hydroxyethoxy)oxan-4-yl]quinoline-4-carboxamide
2-cyclopropyl-N-[(3S,4R)-3-(2-hydroxyethoxy)oxan-4-yl]quinoline-4-carboxamide (PubChem CID 91761737) has the molecular formula C20H24N2O4
and a molecular weight of 356.42 g/mol. Its IUPAC name is 2-cyclopropyl-N-[(3S,4R)-3-(2-hydroxyethoxy)oxan-4-yl]quinoline-4-carboxamide.
Molecular Properties
| Compound Name | 2-cyclopropyl-N-[(3S,4R)-3-(2-hydroxyethoxy)oxan-4-yl]quinoline-4-carboxamide |
| PubChem CID | 91761737 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 2-cyclopropyl-N-[(3S,4R)-3-(2-hydroxyethoxy)oxan-4-yl]quinoline-4-carboxamide |
| SMILES | O=C(N[C@@H]1CCOC[C@H]1OCCO)c1cc(C2CC2)nc2ccccc12 |
| InChI | InChI=1S/C20H24N2O4/c23-8-10-26-19-12-25-9-7-17(19)22-20(24)15-11-18(13-5-6-13)21-16-4-2-1-3-14(15)16/h1-4,11,13,17,19,23H,5-10,12H2,(H,22,24)/t17-,19-/m1/s1 |
| InChIKey | APPIDNFFFNFFBZ-IEBWSBKVSA-N |
| XLogP | 2.01 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-cyclopropyl-N-[(3S,4R)-3-(2-hydroxyethoxy)oxan-4-yl]quinoline-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-N-[(3S,4R)-3-(2-hydroxyethoxy)oxan-4-yl]quinoline-4-carboxamide?
The IUPAC name of 2-cyclopropyl-N-[(3S,4R)-3-(2-hydroxyethoxy)oxan-4-yl]quinoline-4-carboxamide (CID 91761737) is 2-cyclopropyl-N-[(3S,4R)-3-(2-hydroxyethoxy)oxan-4-yl]quinoline-4-carboxamide.
What is the SMILES notation for 2-cyclopropyl-N-[(3S,4R)-3-(2-hydroxyethoxy)oxan-4-yl]quinoline-4-carboxamide?
The canonical SMILES for 2-cyclopropyl-N-[(3S,4R)-3-(2-hydroxyethoxy)oxan-4-yl]quinoline-4-carboxamide is O=C(N[C@@H]1CCOC[C@H]1OCCO)c1cc(C2CC2)nc2ccccc12.
What is the InChIKey of 2-cyclopropyl-N-[(3S,4R)-3-(2-hydroxyethoxy)oxan-4-yl]quinoline-4-carboxamide?
The InChIKey is APPIDNFFFNFFBZ-IEBWSBKVSA-N. The full InChI is InChI=1S/C20H24N2O4/c23-8-10-26-19-12-25-9-7-17(19)22-20(24)15-11-18(13-5-6-13)21-16-4-2-1-3-14(15)16/h1-4,11,13,17,19,23H,5-10,12H2,(H,22,24)/t17-,19-/m1/s1.
What are the key properties of 2-cyclopropyl-N-[(3S,4R)-3-(2-hydroxyethoxy)oxan-4-yl]quinoline-4-carboxamide?
2-cyclopropyl-N-[(3S,4R)-3-(2-hydroxyethoxy)oxan-4-yl]quinoline-4-carboxamide has a molecular weight of 356.42 g/mol, XLogP of 2.01, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-N-[(3S,4R)-3-(2-hydroxyethoxy)oxan-4-yl]quinoline-4-carboxamide is sourced from PubChem (CID 91761737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).