C15H20N2O2S — CID 91761934
N-[(1R,5R,6S,7R)-6-amino-2-oxabicyclo[3.2.0]heptan-7-yl]-4,5,6,7-tetrahydro-2-benzothiophene-1-carboxamide (PubChem CID 91761934) has the molecular formula C15H20N2O2S and a molecular weight of 292.40 g/mol. Its IUPAC name is N-[(1R,5R,6S,7R)-6-amino-2-oxabicyclo[3.2.0]heptan-7-yl]-4,5,6,7-tetrahydro-2-benzothiophene-1-carboxamide.
| Compound Name | N-[(1R,5R,6S,7R)-6-amino-2-oxabicyclo[3.2.0]heptan-7-yl]-4,5,6,7-tetrahydro-2-benzothiophene-1-carboxamide |
|---|---|
| PubChem CID | 91761934 |
| Molecular Formula | C15H20N2O2S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | N-[(1R,5R,6S,7R)-6-amino-2-oxabicyclo[3.2.0]heptan-7-yl]-4,5,6,7-tetrahydro-2-benzothiophene-1-carboxamide |
| SMILES | N[C@H]1[C@H]2CCO[C@H]2[C@@H]1NC(=O)c1scc2c1CCCC2 |
| InChI | InChI=1S/C15H20N2O2S/c16-11-10-5-6-19-13(10)12(11)17-15(18)14-9-4-2-1-3-8(9)7-20-14/h7,10-13H,1-6,16H2,(H,17,18)/t10-,11+,12-,13-/m1/s1 |
| InChIKey | MHVIPXFLFRDSQA-YVECIDJPSA-N |
| XLogP | 1.47 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |