C18H26N2O3S — CID 91762949
2-hydroxy-4-methylsulfanyl-N-[[4-(piperidine-1-carbonyl)phenyl]methyl]butanamide (PubChem CID 91762949) has the molecular formula C18H26N2O3S and a molecular weight of 350.48 g/mol. Its IUPAC name is 2-hydroxy-4-methylsulfanyl-N-[[4-(piperidine-1-carbonyl)phenyl]methyl]butanamide.
| Compound Name | 2-hydroxy-4-methylsulfanyl-N-[[4-(piperidine-1-carbonyl)phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 91762949 |
| Molecular Formula | C18H26N2O3S |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 2-hydroxy-4-methylsulfanyl-N-[[4-(piperidine-1-carbonyl)phenyl]methyl]butanamide |
| SMILES | CSCCC(O)C(=O)NCc1ccc(C(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C18H26N2O3S/c1-24-12-9-16(21)17(22)19-13-14-5-7-15(8-6-14)18(23)20-10-3-2-4-11-20/h5-8,16,21H,2-4,9-13H2,1H3,(H,19,22) |
| InChIKey | BJXWUKDVMWHJFB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |